| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | LOTAUSTRALIN Basic information |
| Product Name: | LOTAUSTRALIN | | Synonyms: | (2R)-2-(β-D-Glucopyranosyloxy)-2-methylbutanenitrile;(2R)-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutanenitrile;(2R)-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-butanenitrile;(2R)-2-methyl-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-methylol-tetrahydropyran-2-yl]oxy-butyronitrile;(R)-Lotaustralin;2-(BETA-D-GLUCOPYRANOSYLOXY)-2-METHYLBUTYRONITRILE;LOTAUSTRALIN;2-(b-D-Glucopyranosyloxy)-2-methylbutyronitrile | | CAS: | 534-67-8 | | MF: | C11H19NO6 | | MW: | 261.27 | | EINECS: | | | Product Categories: | Carbohydrates & Derivatives | | Mol File: | 534-67-8.mol |  |
| | LOTAUSTRALIN Chemical Properties |
| Melting point | 106 - 109°C | | Boiling point | 479.066±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.364±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly, Heated, Sonicated) | | form | Solid | | pka | 12.727±0.70(predicted) | | color | White to Pale Yellow | | Stability: | Hygroscopic | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C11H19NO6/c1-3-11(2,5-12)18-10-9(16)8(15)7(14)6(4-13)17-10/h6-10,13-16H,3-4H2,1-2H3/t6-,7-,8+,9-,10+,11/m1/s1 | | InChIKey | WEWBWVMTOYUPHH-GXUZYPEDSA-N | | SMILES | O[C@@H]1[C@H]([C@@H](O[C@@H]([C@H]1O)CO)OC(C#N)(CC)C)O | | CAS DataBase Reference | 534-67-8 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | LOTAUSTRALIN Usage And Synthesis |
| Chemical Properties | Oil Foam | | Uses | A bioactive constituent of Chinese natural medicines. | | Definition | ChEBI: Lotaustralin is a cyanogenic glycoside. | | General Description | Natural product derived from plant source. |
| | LOTAUSTRALIN Preparation Products And Raw materials |
|