|
|
| | 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde Basic information |
| | 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde Chemical Properties |
| form | solid | | InChI | 1S/C11H7Cl2NO/c1-6-2-3-9(12)8-4-7(5-15)11(13)14-10(6)8/h2-5H,1H3 | | InChIKey | MZAQCBDOHHPKOV-UHFFFAOYSA-N | | SMILES | Cc1ccc(Cl)c2cc(C=O)c(Cl)nc12 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| | 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde Usage And Synthesis |
| | 2,5-Dichloro-8-methylquinoline-3-carboxaldehyde Preparation Products And Raw materials |
|