| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- ESCULIN
-
- $8.00
-
2020-02-21
- CAS:66778-17-4
- Min. Order: 1g
- Purity: >98% HPLC
|
| | Esculin Sesquihydrate Basic information |
| Product Name: | Esculin Sesquihydrate | | Synonyms: | 6,7-Dihydroxycoumarin 6-glucoside, Aesculin, Aesculinum, Esculetin-6-beta-D-glucopyranoside;ESCULIN 1,5H2O;ESCULETIN-6-BETA-D-GLUCOPYRANOSIDE SESQUIHYDRATE;ESCULETIN-6-GLUCOSIDE;ESCULETIN 6-GLUCOSIDE HYDRATE;ESCULETIN-6-O-GLUCOSIDE;(-)-ESCULIN 1.5-HYDRATE;ESCULIN 1.5-WATER | | CAS: | 66778-17-4 | | MF: | C30H38O21 | | MW: | 734.613 | | EINECS: | 208-517-5 | | Product Categories: | | | Mol File: | 66778-17-4.mol |  |
| | Esculin Sesquihydrate Chemical Properties |
| Melting point | 203-205 °C | | density | 0.791 g/mL at 20 °C | | bulk density | 200kg/m3 | | storage temp. | Store at +15°C to +25°C. | | solubility | methanol: 50 mg/mL hot, clear to very faintly turbid, yellow-green fluoresc. | | form | Solid | | color | White to off white | | Water Solubility | Slightly soluble in water. | | Sensitive | Air Sensitive & Hygroscopic | | Merck | 14,3698 | | BRN | 95387 | | Stability: | Hygroscopic | | Major Application | microbiology | | InChI | 1S/C15H16O9.H2O/c16-5-10-12(19)13(20)14(21)15(24-10)23-9-3-6-1-2-11(18)22-8(6)4-7(9)17;/h1-4,10,12-17,19-21H,5H2;1H2/t10-,12-,13+,14-,15-;/m1./s1 | | InChIKey | CQYPGSKIFJFVDQ-QWFKVUSTSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2cc3c([o][c](cc3)=O)cc2O.O | | CAS DataBase Reference | 66778-17-4 |
| | Esculin Sesquihydrate Usage And Synthesis |
| Uses | Esculin sesquihydrate is used to inhibits chemically induced carcinogenesis in mouse skin and kidney, used in a microbiology laboratory to aid in the identification of bacterial species, a naturally occurring antioxidant. | | Definition | ChEBI: Esculin hydrate is a hydrate that is the monohydrate form of anhydrous esculin. It has a role as an antioxidant. It contains an esculin. |
| | Esculin Sesquihydrate Preparation Products And Raw materials |
|