| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | 3,4-Cyclohexenoesculetin β-D-galactopyranoside Basic information |
| Product Name: | 3,4-Cyclohexenoesculetin β-D-galactopyranoside | | Synonyms: | S-Gal (dye);3,4-Cyclohexenoesculetin b-D-galactopyranoside;3,4-Cyclohexenoesculetin β-D-galactopyranoside;3-(beta-D-Galactopyranosyloxy)-7,8,9,10-tetrahydro-2-hydroxy-6H-dibenzo[b,d]pyran-6-one;6H-Dibenzo[b,d]pyran-6-one, 3-(β-D-galactopyranosyloxy)-7,8,9,10-tetrahydro-2-hydroxy-;3,4-cyclohexenoesculetin-β-d-galactopyranoside | | CAS: | 182805-65-8 | | MF: | C19H22O9 | | MW: | 394.38 | | EINECS: | | | Product Categories: | | | Mol File: | 182805-65-8.mol |  |
| | 3,4-Cyclohexenoesculetin β-D-galactopyranoside Chemical Properties |
| Boiling point | 733.2±60.0 °C(Predicted) | | density | 1.62±0.1 g/cm3(Predicted) | | storage temp. | room temp | | solubility | DMF: soluble50mg/mL | | form | powder | | pka | 8.36±0.20(Predicted) | | InChI | 1S/C19H22O9/c20-7-14-15(22)16(23)17(24)19(28-14)27-13-6-12-10(5-11(13)21)8-3-1-2-4-9(8)18(25)26-12/h5-6,14-17,19-24H,1-4,7H2/t14-,15+,16+,17-,19-/m1/s1 | | InChIKey | HDJJDRXZHJRVGA-DIKXUDHVSA-N | | SMILES | OC[C@H]1O[C@@H](Oc2cc3OC(=O)C4=C(CCCC4)c3cc2O)[C@H](O)[C@@H](O)[C@H]1O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3,4-Cyclohexenoesculetin β-D-galactopyranoside Usage And Synthesis |
| Uses | 3,4-Cyclohexenoesculetin β-D-Galactopyranoside is a patented autoclavable chromogenic substrate for β-galactosidase. |
| | 3,4-Cyclohexenoesculetin β-D-galactopyranoside Preparation Products And Raw materials |
|