|
|
| | 4-Amino-6,7-dimethylquinoline Basic information |
| | 4-Amino-6,7-dimethylquinoline Chemical Properties |
| Boiling point | 364.1±37.0 °C(Predicted) | | density | 1.136±0.06 g/cm3(Predicted) | | pka | 9.80±0.50(Predicted) | | form | solid | | InChI | 1S/C11H12N2/c1-7-5-9-10(12)3-4-13-11(9)6-8(7)2/h3-6H,1-2H3,(H2,12,13) | | InChIKey | RVSUQWRJJVMGPB-UHFFFAOYSA-N | | SMILES | NC1=CC=NC2=CC(C)=C(C)C=C21 |
| Risk Statements | 41 | | Safety Statements | 26-39 | | WGK Germany | WGK 3 | | HS Code | 2933499090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | 4-Amino-6,7-dimethylquinoline Usage And Synthesis |
| | 4-Amino-6,7-dimethylquinoline Preparation Products And Raw materials |
|