|
|
| | SPIRO[2.5]OCTAN-6-ONE Basic information |
| Product Name: | SPIRO[2.5]OCTAN-6-ONE | | Synonyms: | SPIRO[2.5]OCTAN-6-ONE;8-methylidene-1,4-dioxaspiro[4.5]decane;Spiro[2.5]octan-6-one (8CI, 9CI, ACI);spiro[2.5]octan-6-one - [S83279] | | CAS: | 15811-21-9 | | MF: | C8H12O | | MW: | 124.18 | | EINECS: | | | Product Categories: | | | Mol File: | 15811-21-9.mol | ![SPIRO[2.5]OCTAN-6-ONE Structure](CAS/GIF/15811-21-9.gif) |
| | SPIRO[2.5]OCTAN-6-ONE Chemical Properties |
| Boiling point | 194.2±8.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H12O/c9-7-1-3-8(4-2-7)5-6-8/h1-6H2 | | InChIKey | PXIGSUWVCSOFMF-UHFFFAOYSA-N | | SMILES | C1C2(CCC(=O)CC2)C1 |
| | SPIRO[2.5]OCTAN-6-ONE Usage And Synthesis |
| Uses | Spiro[2.5]octan-6-one can be used as P2X3 inhibitors to treat P2X3 receptor dysfunction diseases. |
| | SPIRO[2.5]OCTAN-6-ONE Preparation Products And Raw materials |
|