| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester Basic information |
| Product Name: | 2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester | | Synonyms: | 2,3-Dihydro-2-oxo-1H-indole-6-carboxylic acid ethyl ester;Ethyl 2-oxoindoline-6-carboxylate;Nintedanib Impurity 13;Nidanib impurity 1: 2-oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester;1H-Indole-6-carboxylic acid, 2,3-dihydro-2-oxo-, ethyl ester;ethyl 2-oxo-1,3-dihydroindole-6-carboxylate;Ethyl 2,3-dihydro-2-oxo-1H-indole-6-carboxylate;2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester | | CAS: | 954239-49-7 | | MF: | C11H11NO3 | | MW: | 205.21 | | EINECS: | | | Product Categories: | | | Mol File: | 954239-49-7.mol |  |
| | 2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester Chemical Properties |
| Boiling point | 394.5±42.0 °C(Predicted) | | density | 1.240 | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 13.54±0.20(Predicted) | | InChI | 1S/C11H11NO3/c1-2-15-11(14)8-4-3-7-6-10(13)12-9(7)5-8/h3-5H,2,6H2,1H3,(H,12,13) | | InChIKey | SDMAVFXBWFYTCI-UHFFFAOYSA-N | | SMILES | O=C(OCC)C1=CC(NC(C2)=O)=C2C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Skin Sens. 1 |
| | 2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester Usage And Synthesis |
| | 2-Oxo-2,3-dihydro-1H-indole-6-carboxylic acid ethyl ester Preparation Products And Raw materials |
|