3,5-Diacetoxystyrene manufacturers
- 3,5-Diacetoxystyrene
-
-
2025-06-04
- CAS:155222-48-3
- Min. Order: 10g
- Purity: 97%+
- Supply Ability: 100000kgs per Month
|
| | 3,5-Diacetoxystyrene Basic information |
| | 3,5-Diacetoxystyrene Chemical Properties |
| Boiling point | 336.6±35.0 °C(Predicted) | | density | 1.155±0.06 g/cm3(Predicted) | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform, Methanol | | form | Oil | | color | Pale Yellow | | InChI | InChI=1S/C12H12O4/c1-4-10-5-11(15-8(2)13)7-12(6-10)16-9(3)14/h4-7H,1H2,2-3H3 | | InChIKey | JEKQGWWKEWSQCU-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC(C=C)=CC(OC(=O)C)=C1 |
| | 3,5-Diacetoxystyrene Usage And Synthesis |
| Chemical Properties | Pale Yellow Oil | | Uses | Intermediate for the synthesis of Resveratrol |
| | 3,5-Diacetoxystyrene Preparation Products And Raw materials |
|