| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
- Montelukast Styrene
-
-
2019-12-25
- CAS:918972-54-0
- Min. Order: 1KG
- Purity: 95%-99%
- Supply Ability: 1kg; 100kg； 500kg
|
| | Montelukast Styrene Basic information |
| Product Name: | Montelukast Styrene | | Synonyms: | 1-[[[(1R)-1-[3-[(1E)-2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-[2-(1-Methylethenyl)phenyl]propyl]thio]Methyl];Montelukast Styrene;Montelukast EP IMpurity B;Montelukast Methylstyrene IMpurity;Cyclopropaneacetic acid, 1-[[[(1R)-1-[3-[(1E)-2-(7-chloro-2-quinolinyl)ethenyl]phenyl]-3-[2-(1-Methylethenyl)phenyl] propyl]thio]Methyl]-;1-[[[(1R)-1-[3-[(1E)-2-(7-Chloro-2-quinolinyl)ethenyl]phenyl]-3-[2-(1-methy lethenyl)phenyl]propyl]thio]methyl]cyclopropaneacetic Acid;Montelukast Sodium EP impurity B;Montelukast Impurity C | | CAS: | 918972-54-0 | | MF: | C35H34ClNO2S | | MW: | 568.17 | | EINECS: | | | Product Categories: | Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds | | Mol File: | 918972-54-0.mol |  |
| | Montelukast Styrene Chemical Properties |
| Melting point | 154-156°C | | Boiling point | 729.2±60.0 °C(Predicted) | | density | 1.238±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | Solid | | pka | 4.76±0.10(Predicted) | | color | Pale Green to Light Yellow | | InChIKey | LLGQICNFACCGPR-LDXVMNHOSA-N | | SMILES | C1(CS[C@@H](C2=CC=CC(/C=C/C3C=CC4C(N=3)=CC(Cl)=CC=4)=C2)CCC2=CC=CC=C2C(C)=C)(CC(O)=O)CC1 |
| | Montelukast Styrene Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | Montelukast Styrene (Montelukast EP Impurity B; Montelukast USP Related Compound F; Montelukast Methylstyrene; Styrene Montelukast) is a Montelukast impurity. |
| | Montelukast Styrene Preparation Products And Raw materials |
|