|
|
| | Montelukast Sulfoxide(Mixture of diastereomers) Basic information |
| | Montelukast Sulfoxide(Mixture of diastereomers) Chemical Properties |
| Melting point | 95-97°C | | Boiling point | 818.5±65.0 °C(Predicted) | | density | 1.319 | | storage temp. | Amber Vial, -20°C Freezer, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.76±0.10(Predicted) | | form | Solid | | color | Pale Yellow to Dark Yellow | | Stability: | Light Sensitive | | InChIKey | QFTNWCBEAVHLQA-UHFFFAOYSA-N | | SMILES | C1(CS(C(C2=CC=CC(C=CC3C=CC4C(N=3)=CC(Cl)=CC=4)=C2)CCC2=CC=CC=C2C(O)(C)C)=O)(CC(O)=O)CC1 |
| | Montelukast Sulfoxide(Mixture of diastereomers) Usage And Synthesis |
| Chemical Properties | Light Yellow Solid | | Uses | Montelukast Sulfoxide (Montelukast EP Impurity C; Montelukast USP Related Compound A; Montelukast Sulfoxid) is a metabolite of Montelukast. |
| | Montelukast Sulfoxide(Mixture of diastereomers) Preparation Products And Raw materials |
|