1-Amino-8-chloronaphthalene manufacturers
|
| | 1-Amino-8-chloronaphthalene Basic information | | Uses |
| Product Name: | 1-Amino-8-chloronaphthalene | | Synonyms: | 8-Chloro-phthalen-1-ylamine;1-Amino-8-chloronaphthalene;8-Chloro-1-aminonaphthalene;8-Chloro-1-naphthalenamine;8-chloronaphthalen-1-amine(WX130322);8-Chloro-naphthalen-1-ylamine;1-Naphthalenamine, 8-chloro-;1-Amino-8-chloronaphthalene ISO 9001：2015 REACH | | CAS: | 59107-51-6 | | MF: | C10H8ClN | | MW: | 177.63 | | EINECS: | | | Product Categories: | | | Mol File: | 59107-51-6.mol |  |
| | 1-Amino-8-chloronaphthalene Chemical Properties |
| Melting point | 93-94 °C | | Boiling point | 336.4±17.0 °C(Predicted) | | density | 1.289±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | pka | 3.24±0.10(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C10H8ClN/c11-8-5-1-3-7-4-2-6-9(12)10(7)8/h1-6H,12H2 | | InChIKey | LQIZPCZWJJQIKV-UHFFFAOYSA-N | | SMILES | C1(N)=C2C(C=CC=C2Cl)=CC=C1 |
| | 1-Amino-8-chloronaphthalene Usage And Synthesis |
| Uses | 8-Chloro-1-aminonaphthalene can be used as a pharmaceutical synthesis intermediate. It can be prepared from naphthalene 1,8-diamine as a reaction raw material to intermediate 1H-naphtho[1,8-de][1,2,3]triazine, and then further reacted with copper to obtain the final product. |
| | 1-Amino-8-chloronaphthalene Preparation Products And Raw materials |
|