- 4-Ethylbenzenesulfonic acid
-
- $15.00 / 1KG
-
2021-08-12
- CAS:98-69-1
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Ethylbenzenesulfonic acid Basic information |
| | 4-Ethylbenzenesulfonic acid Chemical Properties |
| density | 1.229 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5331(lit.) | | Fp | >230 °F | | pka | -0.45±0.50(Predicted) | | Stability: | Combustible. Incompatible with strong oxidizing agents, strong bases. | | InChI | InChI=1S/C8H10O3S/c1-2-7-3-5-8(6-4-7)12(9,10)11/h3-6H,2H2,1H3,(H,9,10,11) | | InChIKey | BRIXOPDYGQCZFO-UHFFFAOYSA-N | | SMILES | C1(S(O)(=O)=O)=CC=C(CC)C=C1 | | CAS DataBase Reference | 98-69-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonic acid, 4-ethyl- (98-69-1) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-28-36/37/39-45 | | RIDADR | UN 2586 8/PG 3 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B | | Hazardous Substances Data | 98-69-1(Hazardous Substances Data) |
| | 4-Ethylbenzenesulfonic acid Usage And Synthesis |
| Chemical Properties | Solid. | | Uses | 4-Ethylbenzenesulfonic acid was used to dope high conducting polypyrrole thin films. | | Definition | ChEBI: 4-ethylphenylsulfonic acid is a sulfonic acid derivative. | | Production Methods | 4-Ethylbenzenesulfonic acid is produced by sulfonating ethylbenzene with sulfuric acid. It is separated from the isomers via the aniline salt.
| | Hazard | Corrosive. |
| | 4-Ethylbenzenesulfonic acid Preparation Products And Raw materials |
|