2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester manufacturers
|
| | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester | | Synonyms: | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester;2-Oxa-6-azaspiro[3.5]nonane-6-carboxylic acid, 1,1-diMethylethyl ester;6-Boc-2-oxa-6-azaspiro[3....;6-Boc-2-oxa-6-azaspiro[3.5]nonane, 95%;tert-Butyl 2-oxa-6-azaspiro[3.5]nonane-6-carboxylate;2-Oxa-6-azaspiro[3.5]nonane-6-carboxylic acid tert-butyl ester - O5938;2-Oxa-6-azaspiro[3.5]nonane-6-carboxylic acid tert-butyl ester 97%;tert-butyl 2-oxa-8-azaspiro[3.5]nonane-8-carboxylate | | CAS: | 1245816-29-8 | | MF: | C12H21NO3 | | MW: | 227.3 | | EINECS: | | | Product Categories: | | | Mol File: | 1245816-29-8.mol | ![2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester Structure](CAS/GIF/1245816-29-8.gif) |
| | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester Chemical Properties |
| Melting point | 74-77°C | | Boiling point | 315.8±35.0 °C(Predicted) | | density | 1.10±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | -0.80±0.20(Predicted) | | Appearance | White to yellow Solid | | InChI | 1S/C12H21NO3/c1-11(2,3)16-10(14)13-6-4-5-12(7-13)8-15-9-12/h4-9H2,1-3H3 | | InChIKey | NJHHTWIPJPGHQB-UHFFFAOYSA-N | | SMILES | CC(C)(C)OC(=O)N1CCCC2(COC2)C1 | | CAS DataBase Reference | 1245816-29-8 |
| Risk Statements | 52/53 | | Safety Statements | 61 | | WGK Germany | 3 | | HS Code | 2934999090 | | Storage Class | 13 - Non Combustible Solids |
| | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 2-oxa-6-azaspiro[3,5]nonane-6-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|