|
|
| | N-De(4-sulfonaMidophenyl)-N'-(4-sulfonaMidophenyl) Celecoxib Basic information |
| | N-De(4-sulfonaMidophenyl)-N'-(4-sulfonaMidophenyl) Celecoxib Chemical Properties |
| Melting point | 182 - 187°C | | Boiling point | 529.0±60.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 9.68±0.10(Predicted) | | color | Off-White to Brown | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C17H14F3N3O2S/c1-11-2-4-12(5-3-11)15-10-16(17(18,19)20)23(22-15)13-6-8-14(9-7-13)26(21,24)25/h2-10H,1H3,(H2,21,24,25) | | InChIKey | LGIMTMFJBCXYRP-UHFFFAOYSA-N | | SMILES | C1(S(N)(=O)=O)=CC=C(N2C(C(F)(F)F)=CC(C3=CC=C(C)C=C3)=N2)C=C1 |
| WGK Germany | WGK 3 | | HS Code | 2935909550 | | Storage Class | 11 - Combustible Solids |
| | N-De(4-sulfonaMidophenyl)-N'-(4-sulfonaMidophenyl) Celecoxib Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | N-De(4-sulfonamidophenyl)-N’-(4-sulfonamidophenyl) Celecoxib (Celecoxib EP Impurity B) is an isomeric impurity of Celecoxib (C251000) with selective inhibitory activity against human cyclooxygenase-2. USP Celecoxib Related Compound B |
| | N-De(4-sulfonaMidophenyl)-N'-(4-sulfonaMidophenyl) Celecoxib Preparation Products And Raw materials |
|