3,4-Dimethyl-1H-pyrazole-5-carboxylic acid manufacturers
|
| | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid Basic information |
| Product Name: | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid | | Synonyms: | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid;4,5-Dimethylpyrazole-3-carboxylic acid;4,5-dimethyl-1H-pyrazole-3-carboxylic acid;3,4-Dimethylpyrazole-5-carboxylic Acid;1H-Pyrazole-3-carboxylic acid, 4,5-dimethyl- | | CAS: | 89831-40-3 | | MF: | C6H8N2O2 | | MW: | 140.14 | | EINECS: | | | Product Categories: | | | Mol File: | 89831-40-3.mol |  |
| | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid Chemical Properties |
| Melting point | 276-277℃ | | Boiling point | 385.4±37.0 °C(Predicted) | | density | 1.321 | | storage temp. | 2-8°C | | pka | 16.31±0.50(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H8N2O2/c1-3-4(2)7-8-5(3)6(9)10/h1-2H3,(H,7,8)(H,9,10) | | InChIKey | URZZLPLGTZFNST-UHFFFAOYSA-N | | SMILES | N1C(C)=C(C)C(C(O)=O)=N1 |
| HazardClass | IRRITANT | | HS Code | 2933199090 |
| | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid Usage And Synthesis |
| Uses | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid is used for synthesizing biologically active pyrazole derivatives such as candidate drugs with anti-inflammatory, antibacterial and antitumor activities, and also for preparing pharmacologically active substances including enzyme inhibitors and receptor antagonists. |
| | 3,4-Dimethyl-1H-pyrazole-5-carboxylic acid Preparation Products And Raw materials |
|