|
|
| | Methyl 2-(MethoxyiMino)-2-o-tolylacetate Basic information | | Physical Form |
| Product Name: | Methyl 2-(MethoxyiMino)-2-o-tolylacetate | | Synonyms: | Methyl 2-(MethoxyiMino)-2-o-tolylacetate;(E)-alpha-(Methoxyimino)-2-methylbenzeneacetic acid methyl ester;Methyl (E)-2-MethoxyiMino-[2-(o-Methyl)phenyl] acetate;Benzeneacetic acid, a-(MethoxyiMino)-2-Methyl-, Methyl ester, (E)-;(E)-2-methoxyimino-[(2-O-methyl) phenyl] acetate;methyl-(E)-2-(2-tolyl)-2-methoxyiminoacetate;(E)-α-(Methoxyimino)-2-methyl-benzeneacetic acid methyl ester;Benzeneacetic acid, α-(methoxyimino)-2-methyl-, methyl ester, (αE)- | | CAS: | 120974-97-2 | | MF: | C11H13NO3 | | MW: | 207.23 | | EINECS: | 1533716-785-6 | | Product Categories: | OLED | | Mol File: | 120974-97-2.mol |  |
| | Methyl 2-(MethoxyiMino)-2-o-tolylacetate Chemical Properties |
| Melting point | 66-68℃ | | Boiling point | 282℃ | | density | 1.07 | | Fp | 117℃ | | storage temp. | 2-8°C | | solubility | Dichloromethane (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C11H13NO3/c1-8-6-4-5-7-9(8)10(12-15-3)11(13)14-2/h4-7H,1-3H3/b12-10+ | | InChIKey | YCINJZQUXAFTQD-ZRDIBKRKSA-N | | SMILES | C(OC)(=O)/C(=N/OC)/C1=CC=CC=C1C |
| | Methyl 2-(MethoxyiMino)-2-o-tolylacetate Usage And Synthesis |
| Physical Form | Solid | | Uses | (E)-α-(Methoxyimino)-2-methylbenzeneacetic Acid Methyl Ester is an intermediate in the synthesis of Trifloxystrobin (T778900), a broad-spectrum foliar fungicide used in plant protection. |
| | Methyl 2-(MethoxyiMino)-2-o-tolylacetate Preparation Products And Raw materials |
|