|
|
| | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine Basic information |
| Product Name: | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine | | Synonyms: | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine;cis-3-(Boc-aMino)-5-(trif...;tert-butyl N-[cis-5-(trifluoromethyl)piperidin-3-yl]carbamate;cis-(5-Trifluoromethyl-piperidin-3-yl)-carbamic acid tert-butyl ester;cis-3-(Boc-amino)-5-(trifluoromethyl)piperidine;Carbamic acid, N-[(3R,5S)-5-(trifluoromethyl)-3-piperidinyl]-, 1,1-dimethylethyl ester, rel-;tert-Butyl N-(3R,5S)-5-(trifluoromethyl)-3-piperidylcarbamate;tert-butyl N-[cis-5-(trifluoromethyl)-3-piperidyl]carbamate | | CAS: | 1187055-62-4 | | MF: | C11H19F3N2O2 | | MW: | 268.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1187055-62-4.mol |  |
| | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine Chemical Properties |
| Boiling point | 307.3±42.0 °C(Predicted) | | density | 1.17±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 11.86±0.40(Predicted) | | Appearance | white solid | | InChI | InChI=1/C11H19F3N2O2/c1-10(2,3)18-9(17)16-8-4-7(5-15-6-8)11(12,13)14/h7-8,15H,4-6H2,1-3H3,(H,16,17)/t7-,8+/s3 | | InChIKey | CUNVTZVWJLBPQS-WWXSATIUNA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@@H]1C[C@H](C(F)(F)F)CNC1 |&1:8,10,r| |
| | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine Usage And Synthesis |
| | cis-3-(Boc-aMino)-5-(trifluorMethyl)piperidine Preparation Products And Raw materials |
|