| Company Name: |
Shaanxi Rock New Materials Co., Ltd. Gold
|
| Tel: |
0917-8888777 18691786767 |
| Email: |
liuwei@bjrock.com |
| Products Intro: |
Product Name:Di-μ-chlorobis[2′-(amino-N)[1,1′-biphenyl]-2-yl-C]dipalladium(II) CAS:847616-85-7 Purity:98% Package:5g;50g;500g
|
|
| | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Basic information |
| Product Name: | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) | | Synonyms: | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II);Di-μ-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II);Chloro(2'-aMino-1,1'-biphenyl-2-yl)palladiuM(II) diMer, Min. 98%;Di-Mu-chlorobis[2'-(aMino-N)[1,1'-biphenyl]-2-yl-C]dipalladiuM(II);Bis[2′-(amino-κN)[1,1′-biphenyl]-2-yl-κ;Di-μ-chlorobis[2′-(amino-N)[1,1′-biphenyl]-2-yl-C]dipalladium(II);Chloro(2'-amino-1,1'-biphenyl-2-yl)palladium(II)dimer,min.98%;-biphenyl]-2-yl-C]dipalladium(II) | | CAS: | 847616-85-7 | | MF: | C24H18Cl2N2Pd2 | | MW: | 618.16 | | EINECS: | | | Product Categories: | Pd | | Mol File: | 847616-85-7.mol |  |
| | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Chemical Properties |
| Melting point | 207°C(lit.) | | form | Powder | | color | pale gray | | Sensitive | air sensitive | | InChI | InChI=1S/2C12H9N.2ClH.2Pd/c2*13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;;;;/h2*1-6,8-9,13H;2*1H;;/q2*-2;;;2*+3/p-2 | | InChIKey | FULOGHIJKOYUOO-UHFFFAOYSA-L | | SMILES | [Pd+2]12(NC3=CC=CC=C3C3=CC=CC=[C-]13)[Cl-][Pd+2]1(NC3=CC=CC=C3C3=CC=CC=[C-]13)[Cl-]2 | | CAS DataBase Reference | 847616-85-7 |
| Hazard Codes | Xn | | Risk Statements | 19-36/37/38-40 | | Safety Statements | 26-36/37 | | RIDADR | UN 3175 4.1 / PGII | | WGK Germany | 3 | | HS Code | 2931.90.6000 | | Storage Class | 4.1B - Flammable solid hazardous materials | | Hazard Classifications | Carc. 2 Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |
| | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Usage And Synthesis |
| Uses | Di-μ-chlorobis(2''-amino-1,1''-biphenyl-2-yl-C,N)dipalladium(II) (CAS# 847616-85-7) is an organometallic catalyst for α-arylations of methyl sulfones with aryl chlorIdes, and for cross-coupling reactions of aromatic boronic acids and acyl chlorides. | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| | Di-Mu-chlorobis(2'-aMino-1,1'-biphenyl-2-yl-C,N)dipalladiuM(II) Preparation Products And Raw materials |
|