| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Bis[di-(tert-butyl)(4-trifluoromethylphenyl)phosphine]palladium(II) chloride Basic information |
| | Bis[di-(tert-butyl)(4-trifluoromethylphenyl)phosphine]palladium(II) chloride Chemical Properties |
| Melting point | 230 °C (D) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder | | InChI | 1S/2C15H22F3P.2ClH.Pd/c2*1-13(2,3)19(14(4,5)6)12-9-7-11(8-10-12)15(16,17)18;;;/h2*7-10H,1-6H3;2*1H;/q;;;;+2/p-2 | | InChIKey | ATVRGWRBZLLSJD-UHFFFAOYSA-L | | SMILES | Cl[Pd]Cl.CC(C)(C)P(c1ccc(cc1)C(F)(F)F)C(C)(C)C.CC(C)(C)P(c2ccc(cc2)C(F)(F)F)C(C)(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Bis[di-(tert-butyl)(4-trifluoromethylphenyl)phosphine]palladium(II) chloride Usage And Synthesis |
| Uses | Catalyst for Suzuki Coupling reaction of heteroaryl chlorides | | reaction suitability | core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
| | Bis[di-(tert-butyl)(4-trifluoromethylphenyl)phosphine]palladium(II) chloride Preparation Products And Raw materials |
|