| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
BePharm Ltd |
| Tel: |
400-685-9117 |
| Email: |
market@bepharm.com |
|
| | 1-(5-fluoropentyl)-1H-indole-3-carboxylic acid Basic information |
| Product Name: | 1-(5-fluoropentyl)-1H-indole-3-carboxylic acid | | Synonyms: | 5-fluoro PB-22 3-carboxyindole metabolite;1-(5-fluoropentyl)-1H-indole-3-carboxylic acid;5-Fluoro PB-22 3-carboxyindole metabolite solution;5-fluoro PB-22 3-carboxyindole metabolite (CRM);5F-PB-22 3-carboxyindole metabolite;1H-Indole-3-carboxylic acid, 1-(5-fluoropentyl)- | | CAS: | 1432794-98-3 | | MF: | C14H16FNO2 | | MW: | 249.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1432794-98-3.mol |  |
| | 1-(5-fluoropentyl)-1H-indole-3-carboxylic acid Chemical Properties |
| Boiling point | 439.9±25.0 °C(Predicted) | | density | 1.19±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMF: 30mg/ml; DMSO: 30mg/ml; DMSO:PBS(pH7.2) (1:1): 0.5 mg/ml; Ethanol: 10 mg/ml | | form | A neat solid | | pka | 4.00±0.10(Predicted) | | Major Application | forensics and toxicology
forensics and toxicology | | InChI | 1S/C14H16FNO2/c15-8-4-1-5-9-16-10-12(14(17)18)11-6-2-3-7-13(11)16/h2-3,6-7,10H,1,4-5,8-9H2,(H,17,18) | | InChIKey | DYLIZXRQZRUDLA-UHFFFAOYSA-N | | SMILES | O=C(O)C1=CN(CCCCCF)C2=CC=CC=C21 |
| RIDADR | UN 1648 3 / PGII | | WGK Germany | WGK 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Flam. Liq. 2 |
| | 1-(5-fluoropentyl)-1H-indole-3-carboxylic acid Usage And Synthesis |
| Uses | 1-(5-Fluoropentyl)-1H-indole-3-carboxylic Acid is an intermediate in the synthesis of 5-Fluoro NNEI (F588720), which is a synthetic cannabinoid (CB) and analogue of JWH 018 (P283650). The physiological and toxicological properties of this compound are not known.Synthetic Cannabinoids | | General Description | 5-Fluoro PB-22 3-carboxyindole is a major metabolite of the synthetic cannabinoid 5-Fluoro PB-22, also known as 5F-PB-22. This certified Snap-N-Spike solution is suitable as starting material for calibrators or controls in synthetic cannabinoid GC/MS or LC/MS methods for urine drug testing, forensic analysis, or clinical toxicology applications.
For those synthetic cannabinoids currently controlled at the federal level, our certified solution standards of these substances are DEA-exempt, allowing laboratories to place orders without additional regulatory paperwork. For US customers, state specific regulatory requirements may apply. |
| | 1-(5-fluoropentyl)-1H-indole-3-carboxylic acid Preparation Products And Raw materials |
|