|
|
| | 5-ForMyl-2-Methoxy-benzenesulfonaMide Basic information |
| | 5-ForMyl-2-Methoxy-benzenesulfonaMide Chemical Properties |
| Melting point | >155°C (dec.) | | Boiling point | 458.5±55.0 °C(Predicted) | | density | 1.397±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | pka | 9.72±0.60(Predicted) | | form | Solid | | color | White to Off-White | | Major Application | pharmaceutical | | InChI | 1S/C8H9NO4S/c1-13-7-3-2-6(5-10)4-8(7)14(9,11)12/h2-5H,1H3,(H2,9,11,12) | | InChIKey | HZZZXVQYTQPBPF-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)(N)c1c(ccc(c1)C=O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 5-ForMyl-2-Methoxy-benzenesulfonaMide Usage And Synthesis |
| Uses | 5-Formyl-2-methoxy-benzenesulfonamide is an impurity of Tamsulosin (T006350), a specific α1-adrenoceptor antagonist used in the treatment of benign prostatic hypertrophy. | | Uses | 5-Formyl-2-methoxy-benzenesulfonamide (Tamsulosin EP Impurity E) is an impurity of Tamsulosin (T006350), a specific α1-adrenoceptor antagonist used in the treatment of benign prostatic hypertrophy. |
| | 5-ForMyl-2-Methoxy-benzenesulfonaMide Preparation Products And Raw materials |
|