| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
Umicore CX42 manufacturers
- Umicore CX42
-
- $2.00
-
2026-08-25
- CAS:627878-09-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | Umicore CX42 Basic information |
| Product Name: | Umicore CX42 | | Synonyms: | Umicore CX42;UMicore CX42, 19% Pd, Product of UMicore;CX 42;Dichloro-[1,3-bis(diisopropylphenyl)imidazoliden-2-ylidene]palladium(II) dimer;Dichloro(di-μ-chloro)bis[1,3-bis(2,6-diisopropylphenyl)-2-imidazolidinylidene]dipalladium(II);Palladium,bis[1,3-bis[2,6-bis(1-methylethyl)phenyl]-2-imidazolidinylidene]di-μ-chlorodichlorodi-, stereoisomer (9CI, ACI);stereoisomer of Bis[1,3-bis[2,6-bis(1-methylethyl)pheny]-2-imidazolidinylidene]di-p-chlorodichlorodipalladium | | CAS: | 627878-09-5 | | MF: | C54H78Cl4N4Pd2 | | MW: | 1137.87592 | | EINECS: | | | Product Categories: | | | Mol File: | 627878-09-5.mol |  |
| | Umicore CX42 Chemical Properties |
| Melting point | 309-315°C | | storage temp. | 2-8°C | | form | solid | | InChIKey | PXKQUTZZUXFVTA-UHFFFAOYSA-J | | SMILES | CC(C)c1cccc(C(C)C)c1N2CCN(\C2=[Pd](\Cl)Cl)c3c(cccc3C(C)C)C(C)C.CC(C)c4cccc(C(C)C)c4N5CCN(\C5=[Pd](\Cl)Cl)c6c(cccc6C(C)C)C(C)C |
| Hazard Codes | Xi | | Risk Statements | 36/38 | | Safety Statements | 26-37-46-24/25 | | WGK Germany | 3 | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Umicore CX42 Usage And Synthesis |
| Chemical Properties | Solid | | reaction suitability | core: palladium
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Cross Couplings
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: catalyst |
| | Umicore CX42 Preparation Products And Raw materials |
|