| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Creative Enzymes |
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
|
| | (2,2,3,4,4-d5)-zyMosterol Basic information |
| Product Name: | (2,2,3,4,4-d5)-zyMosterol | | Synonyms: | (2,2,3,4,4-d5)-zyMosterol;(2,2,3,4,4-D5)-ZYMOSTEROL;ZYMOSTEROL-D5;zymosterol-d5 | | CAS: | 1246298-29-2 | | MF: | C27H44O | | MW: | 384.65 | | EINECS: | | | Product Categories: | | | Mol File: | 1246298-29-2.mol |  |
| | (2,2,3,4,4-d5)-zyMosterol Chemical Properties |
| storage temp. | -20°C | | form | powder | | color | White to off-white | | InChIKey | CGSJXLIKVBJVRY-VDWRJBAWSA-N | | SMILES | C[C@]12CCC([C@](CC([2H])([2H])[C@@](O)([2H])C3([2H])[2H])(C)C3CC4)=C4[C@]1([H])CC[C@]2([H])[C@]([H])(C)CCC=C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | (2,2,3,4,4-d5)-zyMosterol Usage And Synthesis |
| Uses | Zymosterol-d5 is the isotope labelled analog of Zymosterol, an sterol intermediate in the biosynthesis of cholesterol (C432501). Cholesterol is a major component of all biological membranes; ~25% of total brain lipid is Cholesterol. Zymosterol was also found to be located in the plasma membrane of cultured human fibroblasts via labeling studies. | | General Description | Zymosterol-d5 is the deuterated form of zymosterol. Zymosterol is a precursor of cholesterol and the synthesis events occur in rough endoplasmic reticulum. | | Biochem/physiol Actions | Zymosterol is a substrate for 24-dehydrocholesterol reductase. It acts as a methyl acceptor and exists as fatty acid ester aerobically-grown yeast cells. |
| | (2,2,3,4,4-d5)-zyMosterol Preparation Products And Raw materials |
|