| Company Name: |
Creative Enzymes |
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
|
| | zymosterone Basic information |
| | zymosterone Chemical Properties |
| Boiling point | 480.3±44.0 °C(Predicted) | | density | 1.00±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | powder | | InChI | 1S/C27H42O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h7,19-20,23-24H,6,8-17H2,1-5H3/t19-,20,23,24,26+,27-/m1/s1 | | InChIKey | AUNLIRXIJAVBNM-ZSFXRWSJSA-N | | SMILES | C[C@]1(CC2)C(CCC3=C1CC[C@@]4(C)C3CCC4[C@@H](CCC=C(C)C)C)CC2=O |
| Storage Class | 11 - Combustible Solids |
| | zymosterone Usage And Synthesis |
| Uses | Zymosterone is analyzed in enzymatic studies such as its conversion from zymosterone to zymosterol using an enzyme, HSD17B7, and a cofactor, reduced NADP. | | Definition | ChEBI: Zymosterol intermediate 2 is a 3-oxo steroid. It has a role as a human metabolite and a Saccharomyces cerevisiae metabolite. It derives from a hydride of a 5alpha-cholestane. | | Biological Activity | Zymosterone is metabolized to cholesterol synthesis intermediate, zymosterol in the presence of enzyme hydroxysteroid (17β) dehydrogenase 7 (HSD17B7). Zymosterone conversion to zymosterol catalyzed by 3-keto sterol reductase (ERG27) is a key step in yeast ergosterol biosynthesis. |
| | zymosterone Preparation Products And Raw materials |
|