|
|
| | Chloro(cyclopentadienyl)(triphenylphosphine)nickel(II) Basic information |
| | Chloro(cyclopentadienyl)(triphenylphosphine)nickel(II) Chemical Properties |
| Melting point | 175 °C (dec.)(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | InChI | 1S/C18H15P.C5H5.ClH.Ni/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-4-5-3-1;;/h1-15H;1-5H;1H;/q;;;+1/p-1 | | InChIKey | PMWXBCDXVGNPAN-UHFFFAOYSA-M | | SMILES | Cl[Ni].[CH]1[CH][CH][CH][CH]1.c2ccc(cc2)P(c3ccccc3)c4ccccc4 | | CAS DataBase Reference | 31904-79-7 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22 | | Safety Statements | 36 | | WGK Germany | 3 | | HS Code | 29319090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| | Chloro(cyclopentadienyl)(triphenylphosphine)nickel(II) Usage And Synthesis |
| Chemical Properties | Bordeaux crystalline powder | | Uses | Reactant for synthesis of:
- Nickel alkynyl and allenylidene complexes
- Organometallic complexes for nonlinear optics
Reactant for insertion of decamethylsilicocene in nickel-choline bonds | | reaction suitability | core: nickel reagent type: catalyst |
| | Chloro(cyclopentadienyl)(triphenylphosphine)nickel(II) Preparation Products And Raw materials |
|