Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate manufacturers
|
| | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate Basic information |
| Product Name: | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate | | Synonyms: | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate;Tris(1,1,1,3,3,3-hexafluoro-2-propyl) Phosphate;Tris(hexafluoroisopropyl)phosphate;2-Propanol, 1,1,1,3,3,3-hexafluoro-, 2,2',2''-phosphate;Tris(1,1,1,3,3,3-hexafluoroisopropyl)phosphat;Phosphoric Acid Tris(1,1,1,3,3,3-hexafluoro-2-propyl) Ester;phosphoric acid,Tri(1,1,1,3,3,3-Hexafluoroisopropyl)ester;Tris(1,1,1,3,3,3-hexafluoropropan-2-yl) phosphate | | CAS: | 66489-68-7 | | MF: | C9H3F18O4P | | MW: | 548.06 | | EINECS: | | | Product Categories: | | | Mol File: | 66489-68-7.mol |  |
| | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate Chemical Properties |
| Melting point | 32°C(lit.) | | Boiling point | 72°C/12mmHg(lit.) | | density | 1.713±0.06 g/cm3(Predicted) | | solubility | soluble in Acetone | | form | powder to lump | | color | White to Yellow to Orange | | InChI | InChI=1S/C9H3F18O4P/c10-4(11,12)1(5(13,14)15)29-32(28,30-2(6(16,17)18)7(19,20)21)31-3(8(22,23)24)9(25,26)27/h1-3H | | InChIKey | QLCATRCPAOPBOP-UHFFFAOYSA-N | | SMILES | P(=O)(OC(C(F)(F)F)C(F)(F)F)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F | | CAS DataBase Reference | 66489-68-7 |
| | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate Usage And Synthesis |
| Uses | Tris(hexafluoroisopropyl)phosphate can be used as a flame retardant electrolyte additive for lithium ion batteries. |
| | Tris(1,1,1,3,3,3-hexafluoroisopropyl) phosphate Preparation Products And Raw materials |
|