|
|
| Product Name: | ZPP | | Synonyms: | Cbz-Pro-Prolinal;N-Benzyloxycarbonyl-L-prolyl-L-prolinal;Phenylmethyl (2S)-2-[(2S)-2-formylpyrrolidine-1-carbonyl]pyrrolidine-1-carboxylate;ZPP;Z-Pro-Pro-CHO, Z-PP-CHO;1-Pyrrolidinecarboxylic acid, 2-[[(2S)-2-formyl-1-pyrrolidinyl]carbonyl]-, phenylmethyl ester, (2S)- | | CAS: | 88795-32-8 | | MF: | C18H22N2O4 | | MW: | 330.38 | | EINECS: | | | Product Categories: | | | Mol File: | 88795-32-8.mol |  |
| Boiling point | 529.1±50.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: ≥10mg/mL | | form | powder | | pka | -2.43±0.40(Predicted) | | color | white to tan | | InChI | 1S/C18H22N2O4/c21-12-15-8-4-10-19(15)17(22)16-9-5-11-20(16)18(23)24-13-14-6-2-1-3-7-14/h1-3,6-7,12,15-16H,4-5,8-11,13H2/t15-,16-/m0/s1 | | InChIKey | ORZXYSPOAVJYRU-HOTGVXAUSA-N | | SMILES | N2([C@@H](CCC2)C(=O)N3[C@@H](CCC3)C=O)C(=O)OCc1ccccc1 |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2 |
| Uses | Z-Pro-prolinal was used to inhibit activation of rekallikrein in Prolylcarboxypeptidase assay in HUVECs. ZPP was also used in assays to identify enzymes important in the processing of angiotensin peptides in human glomerular endothelial cells. | | Biological Activity | Z-Pro-prolinal is a potent, selective inhibitor of Prolyl oligopeptidase (POP), also known as prolyl endopeptidase (PEP or PE). Ki = 1 nM.
POP has been connected to memory and mood through regulation of the brain levels of its peptide substrates, which include AVP, substance P, neurotensin and TRH and is a potential target in cognitive function, memory, and neurodegenerative disorders such as amnesia, Alzheimer′s disease, and depression. POP has recently been reported to be involved in the release of the tetrapeptide acetyl-N-Ser-Asp-Lys-Pro (Ac-SDKP) from its precursor, 43-mer thymosin β4 (Tβ4). Ac-SDKP is involved in hemopoietic stem cell differentiation, is pro-angiogenic and antifibrogenic. | | in vivo | Z-Pro-prolinal (N-Benzyloxycarbonyl-L-prolyl-L-prolinal) (100 mg/kg; p.o.; once) increases septal vasopressin content in rats[3]. | Animal Model: | Male Wistar rats[3] | | Dosage: | 100 mg/kg | | Administration: | Oral administration, once | | Result: | Significantly increased the septal arginine-vasopressin (AVP) content. |
|
| | ZPP Preparation Products And Raw materials |
|