- CYCLOHEXANOL-D12
-
- $1.00
-
2020-01-10
- CAS:66522-78-9
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
|
| | CYCLOHEXANOL-D12 Basic information |
| Product Name: | CYCLOHEXANOL-D12 | | Synonyms: | CYCLOHEXANOL-D12;[2H12]cyclohexanol;CYCLOHEXANOL-D12, 98+ ATOM % D;cyclohexyl alcohol-d12;Cyclohexanol-D12 99.5 Atom % D;Cyclohexan-1,2,2,3,3,4,4,5,5,6,6-d11-ol-d;Cyclohexanol-d12;CYCLOHEXANOL-D12, 98+ ATOM % D, FOR NMR | | CAS: | 66522-78-9 | | MF: | C6H12O | | MW: | 100.16 | | EINECS: | 266-389-6 | | Product Categories: | | | Mol File: | 66522-78-9.mol |  |
| | CYCLOHEXANOL-D12 Chemical Properties |
| Melting point | 20-22 °C (lit.) | | Boiling point | 160-161 °C (lit.) | | density | 1.059 g/mL at 25 °C | | vapor pressure | 1 mm Hg ( 21 °C) | | refractive index | n20/D 1.4608(lit.) | | Fp | 154 °F | | storage temp. | 4°C | | solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly) | | form | Oil | | color | Colourless | | explosive limit | 12.25% | | InChI | 1S/C6H12O/c7-6-4-2-1-3-5-6/h6-7H,1-5H2/i1D2,2D2,3D2,4D2,5D2,6D,7D | | InChIKey | HPXRVTGHNJAIIH-BFHGLDALSA-N | | SMILES | [2H]OC1([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C1([2H])[2H] | | CAS DataBase Reference | 66522-78-9 | | CAS Number Unlabeled | 108-93-0 |
| Hazard Codes | Xn | | Risk Statements | 20/22-37/38 | | Safety Statements | 36/37-24/25 | | WGK Germany | 3 | | Autoignition Temperature | 572 °F | | HS Code | 28459010 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | CYCLOHEXANOL-D12 Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Cyclohexanol-d12 is the deuterated analog of cyclohexane, general organic chemical solvent. It is also used as a precursor to the synthesis of nylon. | | Uses | Cyclohexanol-d12 (CAS# 66522-78-9) is a useful isotopically labeled research compound. |
| | CYCLOHEXANOL-D12 Preparation Products And Raw materials |
|