|
|
| | 4-Amino-6-chloro-benzene-1,3-disulfonyl dichloride Basic information |
| | 4-Amino-6-chloro-benzene-1,3-disulfonyl dichloride Chemical Properties |
| Melting point | 130-132 °C | | Boiling point | 474.2±45.0 °C(Predicted) | | density | 1.834±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Acetone (Slightly), Acetonitrile (Slightly), Chloroform (Slightly), DMSO (Slightly) | | pka | -5.05±0.16(Predicted) | | form | Solid | | color | Pale Brown to Light Brown | | Stability: | Hygroscopic, Moisture Sensitive | | InChI | InChI=1S/C6H4Cl3NO4S2/c7-3-1-4(10)6(16(9,13)14)2-5(3)15(8,11)12/h1-2H,10H2 | | InChIKey | YIZXGHNDQUYDDF-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=C(Cl)C=C(N)C(S(Cl)(=O)=O)=C1 | | CAS DataBase Reference | 671-89-6 |
| | 4-Amino-6-chloro-benzene-1,3-disulfonyl dichloride Usage And Synthesis |
| Chemical Properties | Brown Solid | | Uses | Chlorothiazide intermediate. | | Production Methods | 4-Amino-6-chloro-1,3-benzenedisulfonyl Chloride is obtained by chlorosulfonation of 3-chloroaniline with 11 mol of chlorosulfuric acid at 130 ℃; after the chlorosulfonation mixture is treated with 4 mol of thionyl chloride at 80 ℃, the yield is 90 %. |
| | 4-Amino-6-chloro-benzene-1,3-disulfonyl dichloride Preparation Products And Raw materials |
|