|
|
| | Allopurinol impurity C Basic information |
| Product Name: | Allopurinol impurity C | | Synonyms: | 5-(4H-1,2,4-Triazol-4-yl)-1H-pyrazole-4-carboxamide;Allopurinol Impurity 3(Allopurinol EP Impurity C)(Allopurinol USP Related Compound C );synthesis-005;Allopurinol Related CoMpound C;Allopurinol-001;5-(1,2,4-triazol-4-yl)-1H-pyrazole-4-carboxamide;Allopurinol EP Imp C;Allopurinol EP Impurity C(Allopurinol USP Related Compound C) | | CAS: | 1346604-13-4 | | MF: | C6H6N6O | | MW: | 178.15 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Allopurinol impurity C Chemical Properties |
| Boiling point | 579.3±60.0 °C(Predicted) | | density | 1.85±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | Aqueous Base (Slightly, Heated), DMSO (Slightly) | | form | solid | | pka | 9.36±0.50(Predicted) | | Major Application | pharmaceutical | | InChI | InChI=1S/C6H6N6O/c7-5(13)4-1-8-11-6(4)12-2-9-10-3-12/h1-3H,(H2,7,13)(H,8,11) | | InChIKey | OFCNXPDARWKPPY-UHFFFAOYSA-N | | SMILES | N1C=C(C(N)=O)C(N2C=NN=C2)=N1 |
| RIDADR | UN 3077 9 / PGIII | | WGK Germany | WGK 3 | | HS Code | 2933199050 | | Storage Class | 11 - Combustible Solids |
| | Allopurinol impurity C Usage And Synthesis |
| Uses | 3-(4H-1,2,4-Triazol-4-yl)-1H-pyrazole-4-carboxamide (Allopurinol EP Impurity C) is an impurity of Allopurinol (A547300). |
| | Allopurinol impurity C Preparation Products And Raw materials |
|