| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | alpha-Bromo-4-(diethylamino)acetophenone Basic information |
| Product Name: | alpha-Bromo-4-(diethylamino)acetophenone | | Synonyms: | 4-(N,N-DIETHYLAMINO)PHENACYL BROMIDE;2-BROMO-1-[4-(DIETHYLAMINO)PHENYL]ETHAN-1-ONE;4-(Diethylamino)phenacyl bromide;2-Bromo-1-(4-diethylamino-phenyl)-ethanone;2-bromo-4'-(diethylamino)acetophenone;α-Bromo-4-(diethylamino)acetophenone;Ethanone, 2-bromo-1-[4-(diethylamino)phenyl]-;2-Bromo-4′-(diethylamino)acetophenone, CAS 207986-25-2 | | CAS: | 207986-25-2 | | MF: | C12H16BrNO | | MW: | 270.17 | | EINECS: | 681-536-8 | | Product Categories: | | | Mol File: | 207986-25-2.mol |  |
| | alpha-Bromo-4-(diethylamino)acetophenone Chemical Properties |
| Melting point | 50-52°C | | Boiling point | 357.7±22.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | pka | 3.13±0.32(Predicted) | | form | powder | | color | Yellow | | Water Solubility | It is insoluble in water. | | BRN | 7921481 | | InChI | 1S/C12H16BrNO/c1-3-14(4-2)11-7-5-10(6-8-11)12(15)9-13/h5-8H,3-4,9H2,1-2H3 | | InChIKey | ALTMCDJIFXTEPV-UHFFFAOYSA-N | | SMILES | CCN(CC)c1ccc(cc1)C(=O)CBr | | CAS DataBase Reference | 207986-25-2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-22 | | Safety Statements | 26-36/37/39 | | WGK Germany | WGK 3 | | HS Code | 2922290090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ALFA
| English |
| | alpha-Bromo-4-(diethylamino)acetophenone Usage And Synthesis |
| Uses | 2-Bromo-4'-(diethylamino)acetophenone, is used as a pharmaceutical intermediate. It is also used as a primary and secondary intermediate. |
| | alpha-Bromo-4-(diethylamino)acetophenone Preparation Products And Raw materials |
|