| Company Name: |
Energy Chemical Gold |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
iso-Propyl-d7-amine manufacturers
|
| | iso-Propyl-d7-amine Basic information |
| Product Name: | iso-Propyl-d7-amine | | Synonyms: | 2-Aminopropane-d7;1,1,1,2,3,3,3-heptadeuteriopropan-2-amine:hydrochloride;1,1,1,2,3,3,3-heptadeuteriopropan-2-amine;Propan-d7-2-amine hydrochloride;Propan-2-amine-d7 hydrochloride;2-Propan-1,1,1,2,3,3,3-d7-amine hydrochloride;2-Propanamine-d7 Hydrochloride;Isopropylamine-d7 hydrochloride | | CAS: | 106658-10-0 | | MF: | C3H10ClN | | MW: | 95.57 | | EINECS: | | | Product Categories: | | | Mol File: | 106658-10-0.mol |  |
| | iso-Propyl-d7-amine Chemical Properties |
| Boiling point | 33-34 °C | | density | 0.775 g/mL at 25 °C | | storage temp. | Store at room temperature, keep dry and cool | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C3H9N.ClH/c1-3(2)4;/h3H,4H2,1-2H3;1H | | InChIKey | ISYORFGKSZLPNW-UHFFFAOYSA-N | | SMILES | C([H])(N)(C([H])([H])[H])C([H])([H])[H].Cl |
| | iso-Propyl-d7-amine Usage And Synthesis |
| Uses | Isopropyl-d7-amine Hydrochloride is the hydrochloride analogue of Isopropyl-d7-amine (I823977), which may act as a potential protease inhibitor but also takes part in numerous organic chemical reactions such as amide synthesis. |
| | iso-Propyl-d7-amine Preparation Products And Raw materials |
|