benzyl 4-hydroxybutanoate manufacturers
|
| | benzyl 4-hydroxybutanoate Basic information |
| Product Name: | benzyl 4-hydroxybutanoate | | Synonyms: | benzyl 4-hydroxybutanoate;BENZYL4-HYDROXYBUTANOATE(WXC08681);butanoic acid, 4-hydroxy-, phenylmethyl ester;benzyl 4-hydroxybutanoate ISO 9001：2015 REACH;Phenol,5-iodo-3-methyl- | | CAS: | 91970-62-6 | | MF: | C11H14O3 | | MW: | 194.23 | | EINECS: | | | Product Categories: | | | Mol File: | 91970-62-6.mol |  |
| | benzyl 4-hydroxybutanoate Chemical Properties |
| Boiling point | 322.8±25.0 °C(Predicted) | | density | 1.124±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.85±0.10(Predicted) | | form | Oil | | color | Clear Colorless | | InChI | InChI=1S/C11H14O3/c12-8-4-7-11(13)14-9-10-5-2-1-3-6-10/h1-3,5-6,12H,4,7-9H2 | | InChIKey | CRXCATWWXVJNJF-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)(=O)CCCO |
| | benzyl 4-hydroxybutanoate Usage And Synthesis |
| Uses | 4-Hydroxybutyric Acid Benzyl Ester is used to prepare pyridocarbazolecarboxylic acid amide derivatives with antitumor activities. It is also used to prepare 3-Carboxypropyl Phthalate(C181270), a metabolite of Dibutyl phthalate (DBP) (D429495), which is widely used in consumer products. |
| | benzyl 4-hydroxybutanoate Preparation Products And Raw materials |
|