|
|
| | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine Basic information |
| Product Name: | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine | | Synonyms: | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine;2-chloro-4,6-bis(4-methylphenyl)-1,3,5-triazine;1,3,5-Triazine, 2-chloro-4,6-bis(4-methylphenyl)- | | CAS: | 21902-34-1 | | MF: | C17H14ClN3 | | MW: | 295.77 | | EINECS: | | | Product Categories: | | | Mol File: | 21902-34-1.mol |  |
| | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine Chemical Properties |
| Melting point | 208 °C | | Boiling point | 496.5±48.0 °C(Predicted) | | density | 1.211±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 0.18±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C17H14ClN3/c1-11-3-7-13(8-4-11)15-19-16(21-17(18)20-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3 | | InChIKey | LPSLMIOUKRPZDC-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=C(C)C=C2)N=C(C2=CC=C(C)C=C2)N=C1Cl | | CAS DataBase Reference | 21902-34-1 |
| | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine Usage And Synthesis |
| | 2-chloro-4,6-di-p-tolyl-1,3,5-triazine Preparation Products And Raw materials |
|