|
|
| | 2-Fluoro-5-methoxy-4-nitrobenzoic acid Basic information |
| | 2-Fluoro-5-methoxy-4-nitrobenzoic acid Chemical Properties |
| Boiling point | 413.0±45.0 °C(Predicted) | | density | 1.514±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 2.25±0.13(Predicted) | | Appearance | Off-white to yellow Solid | | InChI | InChI=1S/C8H6FNO5/c1-15-7-2-4(8(11)12)5(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) | | InChIKey | JXCYBTVSPGQRCM-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC(OC)=C([N+]([O-])=O)C=C1F |
| | 2-Fluoro-5-methoxy-4-nitrobenzoic acid Usage And Synthesis |
| Synthesis | 2-Fluoro-5-methoxy-4-nitrobenzoic acid can be synthesized using various methods such as the Friedel-Crafts acylation reaction, the Suzuki-Miyaura coupling reaction, and the Buchwald-Hartwig amination reaction. The Friedel-Crafts acylation reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrobenzoyl chloride with methanol in the presence of a catalyst such as aluminum chloride. The Suzuki-Miyaura coupling reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrophenylboronic acid with 4-chlorobenzoic acid in the presence of a palladium catalyst. The Buchwald-Hartwig amination reaction involves the reaction of 2-fluoro-5-methoxy-4-nitroiodobenzene with potassium phthalimide in the presence of a palladium catalyst. |
| | 2-Fluoro-5-methoxy-4-nitrobenzoic acid Preparation Products And Raw materials |
|