- DIPROPYL PHTHALATE
-
-
2025-04-04
- CAS:131-16-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1ton
- DIPROPYL PHTHALATE
-
- $238.80
-
2019-07-06
- CAS:131-16-8
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1000KG
|
| | DIPROPYL PHTHALATE Basic information |
| | DIPROPYL PHTHALATE Chemical Properties |
| Melting point | -31°C | | Boiling point | 317.5 °C (lit.) | | density | 1.078 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.497(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in chloroform, methanol. | | form | Liquid | | color | Clear colorless | | Water Solubility | 108.1mg/L(20 ºC) | | BRN | 2332522 | | Henry's Law Constant | 2.2×101 mol/(m3Pa) at 25℃, Brockbank (2013) | | InChI | 1S/C14H18O4/c1-3-9-17-13(15)11-7-5-6-8-12(11)14(16)18-10-4-2/h5-8H,3-4,9-10H2,1-2H3 | | InChIKey | MQHNKCZKNAJROC-UHFFFAOYSA-N | | SMILES | CCCOC(=O)c1ccccc1C(=O)OCCC | | CAS DataBase Reference | 131-16-8(CAS DataBase Reference) | | EPA Substance Registry System | Dipropyl phthalate (131-16-8) |
| Hazard Codes | N,Xn | | Risk Statements | 51/53-62 | | Safety Statements | 61-36/37 | | RIDADR | UN 3082 9/PG 3 | | WGK Germany | 3 | | RTECS | TI1940000 | | TSCA | TSCA listed | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29173490 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Repr. 2 |
| | DIPROPYL PHTHALATE Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Di-n-propyl Phthalate is a phthalate metabolite of Di-n-butyl phthalate (D429495) degradation with potential genotoxic effect. | | Uses | | | Uses | Di-n-propyl phthalate is used to make plasticizers and polymer additives. It is also used in chemical reagents, organic intermediates. | | Definition | ChEBI: A phthalate ester that is the dipropyl ester of benzene-1,2-dicarboxylic acid. | | General Description | Colorless liquid. | | Reactivity Profile | DIPROPYL PHTHALATE is an ester. Esters react with acids to liberate heat along with alcohols and acids. Strong oxidizing acids may cause a vigorous reaction that is sufficiently exothermic to ignite the reaction products. Heat is also generated by the interaction of esters with caustic solutions. Flammable hydrogen is generated by mixing esters with alkali metals and hydrides. | | Fire Hazard | Flash point data for DIPROPYL PHTHALATE are not available. DIPROPYL PHTHALATE is probably combustible. | | Safety Profile | Moderately toxic by
intraperitoneal route. Experimental
reproductive effects. An irritant.
Combustible when exposed to heat and
flame. When heated to decomposition it
emits acrid smoke and irritating fumes. |
| | DIPROPYL PHTHALATE Preparation Products And Raw materials |
|