|
|
| | meso-Tetra(4-carboxyphenyl)porphine tetramethyl ester Basic information |
| Product Name: | meso-Tetra(4-carboxyphenyl)porphine tetramethyl ester | | Synonyms: | 5,10,15,20-TETRAKIS-(4-METHOXYCARBONYLPHENYL)-21,23H-PORPHYRIN;RARECHEM AS SA 0036;TETRAMETHYL MESO-TETRAPHENYLPORPHINE-4,4',4'',4'''-TETRACARBOXYLATE;5,10,15,20-Tetrakis[4-(methoxycarbonyl)phenyl]porphyrin;5,10,15,20-Tetra(4-carboxyphenyl)porphine tetramethyl ester;5,10,15,20-meso-Tetrakis[4-(methoxycarbonyl)phenyl]porphyrin;Tetramethyl 4,4',4'',4'''-(5,10,15,20-porphyrintetrayl)tetrabenzo ate;JACS-22112-83-0 | | CAS: | 22112-83-0 | | MF: | C52H38N4O8 | | MW: | 846.88 | | EINECS: | | | Product Categories: | Porphyrins | | Mol File: | Mol File |  |
| | meso-Tetra(4-carboxyphenyl)porphine tetramethyl ester Chemical Properties |
| Melting point | 250 °C | | density | 1.319±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light, stored under nitrogen | | Appearance | Purple to black Solid | | InChIKey | NVCZKUSRWBBGAH-PJEPRTEXSA-N | | SMILES | C1(C2C=CC(C(=O)OC)=CC=2)=C2C=CC(C(C3C=CC(C(=O)OC)=CC=3)=C3C=CC(=C(C4C=CC(C(=O)OC)=CC=4)C4C=CC(N=4)=C(C4C=CC(C(=O)OC)=CC=4)C4=CC=C1N4)N3)=N2 |c:11,31,49,t:27| |
| | meso-Tetra(4-carboxyphenyl)porphine tetramethyl ester Usage And Synthesis |
| Uses | MESO-TETRA(4-CARBOXYPHENYL)PORPHINE TETRAMETHYL ESTER is used as an intermediate for the synthesis of MOF material ligands. |
| | meso-Tetra(4-carboxyphenyl)porphine tetramethyl ester Preparation Products And Raw materials |
|