- 2,2"-DINAPHTHYL ETHER
-
- $15.00 / 1KG
-
2021-08-12
- CAS:613-80-9
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2,2'-DINAPHTHYL ETHER
-
- $1.00 / 1KG
-
2019-07-06
- CAS:613-80-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 2,2'-Dinaphthyl Ether Basic information |
| Product Name: | 2,2'-Dinaphthyl Ether | | Synonyms: | 2-naphthalen-2-yloxynaphthalene;2,2'-oxydinaphthalene;Di-beta-naphthyl ether;2,2'-DINAPHTHYL ETHER;2-(2-Naphthyloxy)naphthalene;Naphthalene, 2,2'-oxybis-;di-2-naphthyl ether;Dinaphthol | | CAS: | 613-80-9 | | MF: | C20H14O | | MW: | 270.33 | | EINECS: | 210-356-0 | | Product Categories: | | | Mol File: | 613-80-9.mol |  |
| | 2,2'-Dinaphthyl Ether Chemical Properties |
| Melting point | 105°C | | Boiling point | 250 °C / 19mmHg | | density | 1.0717 (rough estimate) | | refractive index | 1.6700 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | color | Off-White to Pale Beige | | BRN | 2054097 | | InChI | InChI=1S/C20H14O/c1-3-7-17-13-19(11-9-15(17)5-1)21-20-12-10-16-6-2-4-8-18(16)14-20/h1-14H | | InChIKey | DZRLNYVDCIYXPG-UHFFFAOYSA-N | | SMILES | O(C1=CC=C2C(=C1)C=CC=C2)C1=CC=C2C(=C1)C=CC=C2 | | CAS DataBase Reference | 613-80-9(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | HS Code | 29029090 |
| Provider | Language |
|
ALFA
| English |
| | 2,2'-Dinaphthyl Ether Usage And Synthesis |
| Uses | 2,2''-Dinaphthyl Ether and ethers exhibit antifungal activity against A. niger, A. flavus, A. alternata and F. oxysporum. | | Synthesis | 2,2'-dinaphthyl ether is a Typical aryl ether compound. The method of synthesizing 2,2'-dinaphthyl ether that has been reported so far is, for example, in the presence of potassium tert-butoxide, adopts DMSO, synthesizes 2,2'-dinaphthyl ether under the condition of not using a catalyst.
|
| | 2,2'-Dinaphthyl Ether Preparation Products And Raw materials |
|