| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | 3-Bromo-2,4-difluorobenzaldehyde Basic information |
| | 3-Bromo-2,4-difluorobenzaldehyde Chemical Properties |
| Melting point | 56-57° | | Boiling point | 230.9±35.0 °C(Predicted) | | density | 1.758±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Acetonitrile (Slightly), Chloroform | | form | Colourless Oil to Semi-Solid | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C7H3BrF2O/c8-6-5(9)2-1-4(3-11)7(6)10/h1-3H | | InChIKey | KNUJOBHCYUUMBV-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(F)C(Br)=C1F |
| | 3-Bromo-2,4-difluorobenzaldehyde Usage And Synthesis |
| | 3-Bromo-2,4-difluorobenzaldehyde Preparation Products And Raw materials |
|