| Company Name: |
Daicel Chiral Technologies (China)CO.,LTD
|
| Tel: |
021-50460086-9 15921403865 |
| Email: |
han_yajun@dctc.daicel.com |
| Products Intro: |
Product Name:Regio Isomer Impurity of Bosutinib
CAS:1391063-17-4
Purity:95%HPLC Package:10MG;25MG;50MG;100MG Remarks:DCTI-C-3960
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Bosutinib Isomer
CAS:1391063-17-4
Purity:>95%
|
Bosutinib Impurity 5 manufacturers
- PF-06651481-00
-
- $81.00
-
2026-07-15
- CAS:1391063-17-4
- Purity: 97.57%
- Supply Ability: 10g
|
| | Bosutinib Impurity 5 Basic information |
| Product Name: | Bosutinib Impurity 5 | | Synonyms: | Bosutinib isomer 1;3-Quinolinecarbonitrile, 4-[(3,5-dichloro-4-methoxyphenyl)amino]-6-methoxy-7-[3-(4-methyl-1-piperazinyl)propoxy]-;Bosutinib Isomer I (PF-06651481-00);Bosutinib Isomer I;Bosutinib Impurity | | CAS: | 1391063-17-4 | | MF: | C26H29Cl2N5O3 | | MW: | 530.45 | | EINECS: | | | Product Categories: | | | Mol File: | 1391063-17-4.mol |  |
| | Bosutinib Impurity 5 Chemical Properties |
| Melting point | 207 °C | | Boiling point | 660.157±55.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.366±0.10 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | room temp | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) | | form | Solid | | pka | 7.634±0.10(predicted) | | color | White to Light Brown | | Stability: | Stable under recommended storage conditions., Stable Under Recommended Storage C | | InChIKey | YCLIWTLPTXAGPQ-UHFFFAOYSA-N | | SMILES | CN(CC1)CCN1CCCOC2=C(OC)C=C3C(N=CC(C#N)=C3NC4=CC(Cl)=C(OC)C(Cl)=C4)=C2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Bosutinib Impurity 5 Usage And Synthesis |
| Uses | Kinase inhibitors, such asbosutinib,are useful cancer drugs but their target specificity is not fully understood. 4-[(3,5-Dichloro-4-methoxyphenyl)amino]-6-methoxy-7-[3-(4-methyl-1-piperazinyl)propoxy]-3-quinolinecarbonitrile has been employed as a clinical kinase inhibitor bosutinib to elucidate the recognition mechanism between the ATP-binding site and the compound. | | Biological Activity | PF-06651481-00 is an isomer of orally available dual Src/Abl kinase inhibitor Bosutinib. |
| | Bosutinib Impurity 5 Preparation Products And Raw materials |
|