Zidebactam manufacturers
- Zidebactam
-
- $88.00
-
2026-09-10
- CAS:1436861-97-0
- Purity: 99.22%
- Supply Ability: 10g
- Zidebactam
-
- $88.00
-
2026-07-14
- CAS:1436861-97-0
- Purity: 99.22%
- Supply Ability: 10g
|
| | Zidebactam Basic information |
| Product Name: | Zidebactam | | Synonyms: | Zidebactam;1,6-Diazabicyclo[3.2.1]octane-2-carboxylic acid, 7-oxo-6-(sulfooxy)-, 2-[2-[(3R)-3-piperidinylcarbonyl]hydrazide], (1R,2S,5R)-;(2S,5R)-7-oxo-6-(sulfooxy)-1,6-diazabicyclo[3.2.1] octane-2-carboxylic acid, 2-[2-[(3R)-3-piperidinylcarbonyl]hydrazide ];WCK-5107;WCK 5107,inhibit,WCK5107,Inhibitor,Zidebactam,Bacterial;(1R,2S,5R)-7-Oxo-2-(2-((R)-piperidine-3-carbonyl)hydrazine-1-carbonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl hydrogen sulfate;(1S,2R,5R)-7-oxo-2-(2-((R)-piperidine-3-carbonyl)hydrazine-1-carbonyl)-1,6-diazabicyclo[3.2.1]octan-6-yl hydrogen sulfate | | CAS: | 1436861-97-0 | | MF: | C13H21N5O7S | | MW: | 391.4 | | EINECS: | | | Product Categories: | | | Mol File: | 1436861-97-0.mol |  |
| | Zidebactam Chemical Properties |
| density | 1+-.0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO:250.0(Max Conc. mg/mL);638.73(Max Conc. mM)
Water:50.0(Max Conc. mg/mL);127.75(Max Conc. mM) | | form | A solid | | pka | -4.59±0.18(Predicted) | | color | White to yellow | | InChI | InChI=1/C13H21N5O7S/c19-11(8-2-1-5-14-6-8)15-16-12(20)10-4-3-9-7-17(10)13(21)18(9)25-26(22,23)24/h8-10,14H,1-7H2,(H,15,19)(H,16,20)(H,22,23,24)/t8-,9-,10+/s3 | | InChIKey | YCZPXRQPDCXTIO-GTUQAFHNNA-N | | SMILES | C([C@@H]1CC[C@H]2N(OS(O)(=O)=O)C(=O)[N@@]1C2)(=O)NNC([C@H]1CNCCC1)=O |&1:1,4,13,19,r| |
| | Zidebactam Usage And Synthesis |
| Uses | Zidebactam is a useful raw material for pharmaceutical compositions containing antibacterial agents and their therapeutic uses. |
| | Zidebactam Preparation Products And Raw materials |
|