| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-Guanidinohexanoic acid Basic information |
| Product Name: | 6-Guanidinohexanoic acid | | Synonyms: | epsilon-guanidinocaproate;6-GUANIDINOCAPROIC ACID;6-Guanidine Caproic Acid;6-GUANIDINO-HEXANOIC ACID 98+%;6-GUANIDINOCAPROIC ACID HCL;6-Guanidinecaproic acid hydrochloride;Einecs 229-696-6;epsilon-Guanidinocaproic acid | | CAS: | 6659-35-4 | | MF: | C7H15N3O2 | | MW: | 173.21 | | EINECS: | 229-696-6 | | Product Categories: | | | Mol File: | 6659-35-4.mol |  |
| | 6-Guanidinohexanoic acid Chemical Properties |
| Melting point | ~310 °C (dec.) | | Boiling point | 338.5±44.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | pka | 4.74±0.10(Predicted) | | BRN | 1774244 | | InChI | InChI=1S/C7H15N3O2/c8-7(9)10-5-3-1-2-4-6(11)12/h1-5H2,(H,11,12)(H4,8,9,10) | | InChIKey | NSDYIDKTTPXCRH-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCNC(N)=N |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 6-Guanidinohexanoic acid Usage And Synthesis |
| Definition | ChEBI: A member of the class of guanidines that consists of hexanoic acid substituted by a guanidino group at position 6. | | reaction suitability | reagent type: cross-linking reagent |
| | 6-Guanidinohexanoic acid Preparation Products And Raw materials |
|