|
|
| | D-Arabinose-1-13C Basic information |
| | D-Arabinose-1-13C Chemical Properties |
| Melting point | 163-165 °C(lit.) | | density | 1.508±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | solubility | Water (Slightly) | | form | Solid | | color | White to Off-White | | Optical Rotation | [α]20/D 103°, c = 4 in H2O | | InChI | 1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2/t3-,4-,5+/m1/s1/i1+1 | | InChIKey | PYMYPHUHKUWMLA-PVQXRQKHSA-N | | SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[13CH]=O | | CAS Number Unlabeled | 10323-20-3 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | D-Arabinose-1-13C Usage And Synthesis |
| Uses | D-Arabinose-1-13C is the isotope labelled analogue of D-Arabinose (A764175), an inhibitor of the enzyme glucose dehydrogenase. |
| | D-Arabinose-1-13C Preparation Products And Raw materials |
|