| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
HBCChem, Inc. |
| Tel: |
+1-510-219-6317 |
| Email: |
sales@hbcchem.com |
|
| | 3-(3-Nitrophenyl)pyrazole Basic information |
| Product Name: | 3-(3-Nitrophenyl)pyrazole | | Synonyms: | 3-(3-NITRO-PHENYL)-1H-PYRAZOLE;BUTTPARK 15\04-53;1-Nitro-3-(1H-pyrazol-3-yl)benzene, 3-(1H-Pyrazol-3-yl)nitrobenzene;1H-Pyrazole, 3-(3-nitrophenyl)-;5-(3-Nitro-phenyl)-1H-pyrazole;JR-8741, 3-(3-Nitrophenyl)-1H-pyrazole, 97%;3-(3-Nitrophenyl)-1H-pyrazole,97%;3-(3-Nitrophenyl)-1H-pyrazole | | CAS: | 59843-77-5 | | MF: | C9H7N3O2 | | MW: | 189.17 | | EINECS: | | | Product Categories: | | | Mol File: | 59843-77-5.mol |  |
| | 3-(3-Nitrophenyl)pyrazole Chemical Properties |
| Melting point | 126-128℃ | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | Appearance | Light brown to brown Solid | | InChI | 1S/C9H7N3O2/c13-12(14)8-3-1-2-7(6-8)9-4-5-10-11-9/h1-6H,(H,10,11) | | InChIKey | RUWXJVIBNZSEQD-UHFFFAOYSA-N | | SMILES | [O-][N+](=O)c1cccc(c1)-c2cc[nH]n2 | | CAS DataBase Reference | 59843-77-5 |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HS Code | 2933199090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 3-(3-Nitrophenyl)pyrazole Usage And Synthesis |
| | 3-(3-Nitrophenyl)pyrazole Preparation Products And Raw materials |
|