2,2'-BIPHENYLDIAMINE manufacturers
- 2,2-Diaminobiphenyl
-
- $0.00 / 100G
-
2024-06-11
- CAS:1454-80-4
- Min. Order: 10G
- Purity: 0.98
- Supply Ability: 500kg
- 2,2'-Biphenyldiamine
-
- $1290.00 / 25g
-
2024-02-15
- CAS:1454-80-4
- Min. Order: 1g
- Purity: 96
- Supply Ability: 500 Kg
- 2,2′-Biphenyldiamine
-
- $1.00 / 1KG
-
2020-02-01
- CAS:1454-80-4
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | 2,2'-BIPHENYLDIAMINE Basic information |
| Product Name: | 2,2'-BIPHENYLDIAMINE | | Synonyms: | TIMTEC-BB SBB008458;(1,1’-biphenyl)-2,2’-diamine;2,2’-diaminodiphenyl;2,2'-Diaminodiphenyl;2'-Amino[1,1'-biphenyl]-2-ylamine;o,o’-diaminobiphenyl;o,o'-Diaminobiphenyl;o-Benzidine | | CAS: | 1454-80-4 | | MF: | C12H12N2 | | MW: | 184.24 | | EINECS: | | | Product Categories: | | | Mol File: | 1454-80-4.mol |  |
| | 2,2'-BIPHENYLDIAMINE Chemical Properties |
| Melting point | 76.0 to 80.0 °C | | Boiling point | 151°C/3mmHg(lit.) | | density | 1.3090 | | refractive index | 1.6266 (estimate) | | storage temp. | 2-8°C, protect from light | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.70±0.10(Predicted) | | color | White to Brown | | λmax | 294nm(EtOH)(lit.) | | BRN | 1949579 | | InChI | InChI=1S/C12H12N2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H,13-14H2 | | InChIKey | HOLGXWDGCVTMTB-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2N)=CC=CC=C1N | | CAS DataBase Reference | 1454-80-4 |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-50 | | Safety Statements | 26-39-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | RTECS | DV2099000 | | HS Code | 2921599090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Eye Dam. 1 |
| | 2,2'-BIPHENYLDIAMINE Usage And Synthesis |
| Uses | 2,2''-Biphenyldiamine is a good starting material in the synthesis of carbazole and carbazole derivatives. |
| | 2,2'-BIPHENYLDIAMINE Preparation Products And Raw materials |
|