|
|
| | tert-Butyl 6-oxohexylcarbamate Basic information |
| Product Name: | tert-Butyl 6-oxohexylcarbamate | | Synonyms: | Carbamic acid, (6-oxohexyl)-, 1,1-dimethylethyl ester;tert-Butyl 6-oxohexylcarbamate;Carbamic acid, N-(6-oxohexyl)-, 1,1-dimethylethyl ester;DK921;6-(Boc-amino)hexanal;tert-butyl N-(6-oxohexyl)carbamate;DKFELEX0245;6-Aminohexanal, N-BOC protected | | CAS: | 80860-42-0 | | MF: | C11H21NO3 | | MW: | 215.29 | | EINECS: | | | Product Categories: | | | Mol File: | 80860-42-0.mol |  |
| | tert-Butyl 6-oxohexylcarbamate Chemical Properties |
| Boiling point | 325.9±25.0 °C(Predicted) | | density | 0.979±0.06 g/cm3(Predicted) | | storage temp. | Store at 0-8 °C | | pka | 12.90±0.46(Predicted) | | Appearance | yellow liquid | | InChI | InChI=1S/C11H21NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9-13/h9H,4-8H2,1-3H3,(H,12,14) | | InChIKey | VLXBTPVTHZTXBN-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)NCCCCCC=O |
| | tert-Butyl 6-oxohexylcarbamate Usage And Synthesis |
| Uses | tert-Butyl 6-oxohexylcarbamate is used in organic synthesis. |
| | tert-Butyl 6-oxohexylcarbamate Preparation Products And Raw materials |
|