| Company Name: |
Nextpeptide Inc |
| Tel: |
+86-0571-81612335 +8613336028439 |
| Email: |
sales@nextpeptide.com |
|
| | 3-(2-Carboxyethyl)-aminotetrahydrothiophene, 1,1-dioxide Basic information |
| | 3-(2-Carboxyethyl)-aminotetrahydrothiophene, 1,1-dioxide Chemical Properties |
| form | solid | | InChI | 1S/C7H13NO4S/c9-7(10)1-3-8-6-2-4-13(11,12)5-6/h6,8H,1-5H2,(H,9,10) | | InChIKey | IKVXZBQFTASZSZ-UHFFFAOYSA-N | | SMILES | [S]1(=O)(=O)CC(CC1)[N+H2]CCC(=O)[O-] |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-(2-Carboxyethyl)-aminotetrahydrothiophene, 1,1-dioxide Usage And Synthesis |
| | 3-(2-Carboxyethyl)-aminotetrahydrothiophene, 1,1-dioxide Preparation Products And Raw materials |
|