2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane manufacturers
|
| | 2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane Basic information |
| Product Name: | 2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane | | Synonyms: | 3,3'-[1-Methylethylidenebis(4,1-phenyleneoxy)]bis(1-chloro-2-propanol);3,3'-[Isopropylidenebis(4,1-phenylene)bisoxy]bis(1-chloropropane-2-ol);Bisphenol A bis(3-chloro-2-hydroxypropyl) ether,2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane, BADGE-2HCl;BISPHENOL A BIS(3-CHLORO-2-HYDROXYPROPYL) ETHER;BISPHENOLADIGLYCIDYLETHERBIS-CHLOROHYDRIN;2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane, BADGE-2HCl;1,1'-[(Dimethylmethylene)bis(4,1-phenyleneoxy)]bis(3-chloropropane-2-ol);1,1'-[Dimethylmethylenebis(4,1-phenyleneoxy)]bis(3-chloropropane-2-ol) | | CAS: | 4809-35-2 | | MF: | C21H26Cl2O4 | | MW: | 413.33 | | EINECS: | | | Product Categories: | | | Mol File: | 4809-35-2.mol | ![2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane Structure](CAS/GIF/4809-35-2.gif) |
| | 2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane Chemical Properties |
| Melting point | >58°C (dec.) | | Boiling point | 585.1±50.0 °C(Predicted) | | density | 1.232±0.06 g/cm3(Predicted) | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Choroform (Slightly), Methanol (Slightly) | | pka | 12.83±0.20(Predicted) | | color | White to Off-White | | BRN | 2302053 | | Major Application | cleaning products cosmetics food and beverages personal care | | InChI | 1S/C21H26Cl2O4/c1-21(2,15-3-7-19(8-4-15)26-13-17(24)11-22)16-5-9-20(10-6-16)27-14-18(25)12-23/h3-10,17-18,24-25H,11-14H2,1-2H3 | | InChIKey | PTCFDJRJOGPUFE-UHFFFAOYSA-N | | SMILES | CC(C)(c1ccc(OCC(O)CCl)cc1)c2ccc(OCC(O)CCl)cc2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane Usage And Synthesis |
| Uses | The epoxy resin bisphenol A diglycidyl ether (BADGE), its hydrolysis products and a chlorohydrin of BADGE (BADGE·2HCl), have been examined for their genotoxicity in the micronucleus test and mutagenicity in the Ames Salmonella assay. |
| | 2,2-Bis[4-(3-chloro-2-hydroxypropoxy)phenyl]propane Preparation Products And Raw materials |
|