DL-MANDELAMIDE manufacturers
- DL-MANDELAMIDE
-
- $15.00
-
2021-08-12
- CAS:4410-31-5
- Min. Order: 1KG
- Purity: 99%+ HPLC
|
| Product Name: | DL-MANDELAMIDE | | Synonyms: | 2-HYDROXY-2-PHENYLACETAMIDE;DL-MANDELAMIDE;DL-MANDELAMIDE 98%;2-Phenyl-2-hydroxyacetamide;α-Hydroxybenzeneacetamide;Mandelamide 97%;a-Hydroxy-benzeneacetamide;DL-MANDELAMIDE 2-Hydroxy-2-phenylacetamide | | CAS: | 4410-31-5 | | MF: | C8H9NO2 | | MW: | 151.16 | | EINECS: | | | Product Categories: | Benzene series | | Mol File: | 4410-31-5.mol |  |
| | DL-MANDELAMIDE Chemical Properties |
| Melting point | 133-137 °C(lit.) | | Boiling point | 345.5±35.0 °C(Predicted) | | density | 1.246±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | pka | 12.46±0.20(Predicted) | | Appearance | White to off-white Solid | | BRN | 2208677 | | InChI | InChI=1S/C8H9NO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5,7,10H,(H2,9,11) | | InChIKey | MAGPZHKLEZXLNU-UHFFFAOYSA-N | | SMILES | C1(C(O)C(N)=O)=CC=CC=C1 | | CAS DataBase Reference | 4410-31-5(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-36 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
| | DL-MANDELAMIDE Usage And Synthesis |
| Application | (±)-Mandelamide, also known as D,L-Mandelamide, is an amide compound that may be employed as an intermediate in pharmaceutical synthesis. | | Definition | ChEBI: Mandelamide is a monocarboxylic acid amide that is phenylacetamide in which one of the benzylic hydrogens has been replaced by a hydroxy group. It is a monocarboxylic acid amide, a member of benzyl alcohols and a secondary alcohol. It is functionally related to a phenylacetic acid. | | Synthesis | ()-Mandelic acid amide can be prepared from benzaldehyde as the reaction raw material, reacted with hydrocyanic acid to prepare D,L-mandelic acid nitrile, and then hydrolyzed under acidic conditions to obtain D,L-mandelic acid amide.
|
| | DL-MANDELAMIDE Preparation Products And Raw materials |
|