|
|
| | 1169964-41-3 Basic information |
| Product Name: | 1169964-41-3 | | Synonyms: | 2,4,6-Tris-(4-bromomethyl-phenyl)-[1,3,5]triazine;1,3,5-Triazine, 2,4,6-tris[4-(bromomethyl)phenyl]-;2,4,6-tri(4-(bromethyl)phenyl)-1,3,5-triazine;tris[4-(bromomethyl)phenyl]-1,3,5-triazine;2,4,6-Tris[4-(bromomethyl)phenyl]-s-triazine | | CAS: | 1169964-41-3 | | MF: | C24H18Br3N3 | | MW: | 588.13 | | EINECS: | | | Product Categories: | | | Mol File: | 1169964-41-3.mol |  |
| | 1169964-41-3 Chemical Properties |
| Melting point | 195-197 °C | | Boiling point | 686.0±65.0 °C(Predicted) | | density | 1.664±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 0.51±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C24H18Br3N3/c25-13-16-1-7-19(8-2-16)22-28-23(20-9-3-17(14-26)4-10-20)30-24(29-22)21-11-5-18(15-27)6-12-21/h1-12H,13-15H2 | | InChIKey | IOJQCIAKNZPJAN-UHFFFAOYSA-N | | SMILES | N1=C(C2=CC=C(CBr)C=C2)N=C(C2=CC=C(CBr)C=C2)N=C1C1=CC=C(CBr)C=C1 |
| | 1169964-41-3 Usage And Synthesis |
| | 1169964-41-3 Preparation Products And Raw materials |
|